CAS 60442-29-7 is the registry number for 1H,3H,4H,9H-Pyrano(3,4-b)indole-1,3-dione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4,9-dihydropyrano[3,4-b]indole-1,3-dione (CAS 60442-29-7) is a chemical compound with the molecular formula C11H7NO3 and a molecular weight of 201.18 g/mol. IUPAC name: 4,9-dihydropyrano[3,4-b]indole-1,3-dione. InChIKey: DRBDVHIEYHBCGL-UHFFFAOYSA-N.
| Molecular formula | C11H7NO3 |
|---|---|
| Molecular weight | 201.18 g/mol |
| IUPAC name | 4,9-dihydropyrano[3,4-b]indole-1,3-dione |
| InChIKey | DRBDVHIEYHBCGL-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=O)OC1=O)NC3=CC=CC=C23 |
Computed by PubChem (NCBI)