CAS 1014020-15-5 is the registry number for 4-Fluoro-2-nitro-5-(1H-pyrazol-1-yl)aniline, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-fluoro-2-nitro-5-pyrazol-1-ylaniline (CAS 1014020-15-5) is a chemical compound with the molecular formula C9H7FN4O2 and a molecular weight of 222.18 g/mol. IUPAC name: 4-fluoro-2-nitro-5-pyrazol-1-ylaniline. InChIKey: GRMJVAQREPBDOV-UHFFFAOYSA-N.
| Molecular formula | C9H7FN4O2 |
|---|---|
| Molecular weight | 222.18 g/mol |
| IUPAC name | 4-fluoro-2-nitro-5-pyrazol-1-ylaniline |
| InChIKey | GRMJVAQREPBDOV-UHFFFAOYSA-N |
| SMILES | C1=CN(N=C1)C2=C(C=C(C(=C2)N)[N+](=O)[O-])F |
Computed by PubChem (NCBI)