CAS 1700015-93-5 is the registry number for 2-Fluoro-4-(5-methyl-1H-1,2,3,4-tetrazol-1-yl)benzoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-fluoro-4-(5-methyltetrazol-1-yl)benzoic acid (CAS 1700015-93-5) is a chemical compound with the molecular formula C9H7FN4O2 and a molecular weight of 222.18 g/mol. IUPAC name: 2-fluoro-4-(5-methyltetrazol-1-yl)benzoic acid. InChIKey: QFIRWHRFTUEBLO-UHFFFAOYSA-N.
| Molecular formula | C9H7FN4O2 |
|---|---|
| Molecular weight | 222.18 g/mol |
| IUPAC name | 2-fluoro-4-(5-methyltetrazol-1-yl)benzoic acid |
| InChIKey | QFIRWHRFTUEBLO-UHFFFAOYSA-N |
| SMILES | CC1=NN=NN1C2=CC(=C(C=C2)C(=O)O)F |
Computed by PubChem (NCBI)