CAS 216883-13-5 appears in our catalog under these names: 4-Fluoro-5-(1H-imidazol-1-yl)-2-nitroaniline, 95+%, 4-Fluoro-5-(1H-imidazol-1-yl)-2-nitroaniline. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
4-fluoro-5-imidazol-1-yl-2-nitroaniline (CAS 216883-13-5) is a chemical compound with the molecular formula C9H7FN4O2 and a molecular weight of 222.18 g/mol. IUPAC name: 4-fluoro-5-imidazol-1-yl-2-nitroaniline. InChIKey: JPUAGHMSXTVEGG-UHFFFAOYSA-N.
| Molecular formula | C9H7FN4O2 |
|---|---|
| Molecular weight | 222.18 g/mol |
| IUPAC name | 4-fluoro-5-imidazol-1-yl-2-nitroaniline |
| InChIKey | JPUAGHMSXTVEGG-UHFFFAOYSA-N |
| SMILES | C1=CN(C=N1)C2=C(C=C(C(=C2)N)[N+](=O)[O-])F |
Computed by PubChem (NCBI)