Products 1014081-44-7
CAS 1014081-44-7 is the registry number for 1-((1S)-3-Carbamoyl-1-carboxypropyl)-4,5-dimethyl-1H-imidazol-3-ium-3-olate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(2S)-5-amino-2-(4,5-dimethyl-3-oxidoimidazol-3-ium-1-yl)-5-oxopentanoic acid (CAS 1014081-44-7) is a chemical compound with the molecular formula C10H15N3O4 and a molecular weight of 241.24 g/mol. IUPAC name: (2S)-5-amino-2-(4,5-dimethyl-3-oxidoimidazol-3-ium-1-yl)-5-oxopentanoic acid. InChIKey: JWUWLMPKIWTYMC-QMMMGPOBSA-N.
| Molecular formula | C10H15N3O4 |
|---|---|
| Molecular weight | 241.24 g/mol |
| IUPAC name | (2S)-5-amino-2-(4,5-dimethyl-3-oxidoimidazol-3-ium-1-yl)-5-oxopentanoic acid |
| InChIKey | JWUWLMPKIWTYMC-QMMMGPOBSA-N |
| SMILES | CC1=C([N+](=CN1[C@@H](CCC(=O)N)C(=O)O)[O-])C |
Computed by PubChem (NCBI)