CAS 10145-39-8 is the registry number for 2-Amino-5-(p-bromophenyl)-2-oxazoline. Offered by: TRC. Available pack sizes: 500mg.
5-(4-bromophenyl)-4,5-dihydro-1,3-oxazol-2-amine (CAS 10145-39-8) is a chemical compound with the molecular formula C9H9BrN2O and a molecular weight of 241.08 g/mol. IUPAC name: 5-(4-bromophenyl)-4,5-dihydro-1,3-oxazol-2-amine. InChIKey: QKNWNIQGFNMGFH-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2O |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | 5-(4-bromophenyl)-4,5-dihydro-1,3-oxazol-2-amine |
| InChIKey | QKNWNIQGFNMGFH-UHFFFAOYSA-N |
| SMILES | C1C(OC(=N1)N)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)