CAS 10148-67-1 is the registry number for (2S,3R)–2–Amino–3–hydroxypentanoic acid. Offered by: GLPBio. Available pack sizes: 10mg.
(2S,3R)-2-amino-3-hydroxypentanoic acid (CAS 10148-67-1) is a chemical compound with the molecular formula C5H11NO3 and a molecular weight of 133.15 g/mol. IUPAC name: (2S,3R)-2-amino-3-hydroxypentanoic acid. InChIKey: LGVJIYCMHMKTPB-DMTCNVIQSA-N.
| Molecular formula | C5H11NO3 |
|---|---|
| Molecular weight | 133.15 g/mol |
| IUPAC name | (2S,3R)-2-amino-3-hydroxypentanoic acid |
| InChIKey | LGVJIYCMHMKTPB-DMTCNVIQSA-N |
| SMILES | CC[C@H]([C@@H](C(=O)O)N)O |
Computed by PubChem (NCBI)