Products 2076-43-9

CAS 2076-43-9 is the registry number for rel-(2S,3R)-2-Amino-3-hydroxypentanoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.

Structural formula: {0} (CAS {1})

(2S,3R)-2-amino-3-hydroxypentanoic acid (CAS 2076-43-9) is a chemical compound with the molecular formula C5H11NO3 and a molecular weight of 133.15 g/mol. IUPAC name: (2S,3R)-2-amino-3-hydroxypentanoic acid. InChIKey: LGVJIYCMHMKTPB-DMTCNVIQSA-N.

Identity
Molecular formulaC5H11NO3
Molecular weight133.15 g/mol
IUPAC name(2S,3R)-2-amino-3-hydroxypentanoic acid
InChIKeyLGVJIYCMHMKTPB-DMTCNVIQSA-N
SMILESCC[C@H]([C@@H](C(=O)O)N)O

Computed by PubChem (NCBI)