CAS 10149-14-1 is the registry number for 3-Deoxy-D-manno-octulosonic acid, 98+%. Offered by: Chemat Brand. Available pack sizes: on request.
Keto-3-deoxy-D-manno-octulosonic acid is a 3-deoxy-D-manno-octulosonic acid. It is a conjugate acid of a keto-3-deoxy-D-manno-octulosonate.
Source: ChEBI
| Molecular formula | C8H14O8 |
|---|---|
| Molecular weight | 238.19 g/mol |
| IUPAC name | (4R,5R,6R,7R)-4,5,6,7,8-pentahydroxy-2-oxooctanoic acid |
| InChIKey | KYQCXUMVJGMDNG-SHUUEZRQSA-N |
| SMILES | C([C@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O)C(=O)C(=O)O |
Computed by PubChem (NCBI)