CAS 95350-40-6 appears in our catalog under these names: 2-O-Carboxymethyl-D-glucose, 2–(((2R,3S,4R,5R)–3,4,5,6–tetrahydroxy–1–oxohexan–2–yl)oxy)acetic acid, 2-O-(Carboxymethyl)-D-glucose. Offered by: TRC, GLPBio, Biosynth, Chemat. Available pack sizes: 50mg, 1mg, 5mg, 25mg, 10mg, 2mg.
2-[(2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]oxyacetic acid (CAS 95350-40-6) is a chemical compound with the molecular formula C8H14O8 and a molecular weight of 238.19 g/mol. IUPAC name: 2-[(2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]oxyacetic acid. InChIKey: IPDDFPVVVTYLKI-IXROVEORSA-N.
| Molecular formula | C8H14O8 |
|---|---|
| Molecular weight | 238.19 g/mol |
| IUPAC name | 2-[(2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]oxyacetic acid |
| InChIKey | IPDDFPVVVTYLKI-IXROVEORSA-N |
| SMILES | C([C@H]([C@H]([C@@H]([C@H](C=O)OCC(=O)O)O)O)O)O |
Computed by PubChem (NCBI)