CAS 95350-38-2 appears in our catalog under these names: 6-O-Carboxymethyl-D-glucose, 2–(((2R,3R,4S,5R)–2,3,4,5–tetrahydroxy–6–oxohexyl)oxy)acetic acid, 6-O-(Carboxymethyl)-D-glucose. Offered by: TRC, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 1mg, 5mg, 2mg, 10mg, 25mg, 50mg.
2-[(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexoxy]acetic acid (CAS 95350-38-2) is a chemical compound with the molecular formula C8H14O8 and a molecular weight of 238.19 g/mol. IUPAC name: 2-[(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexoxy]acetic acid. InChIKey: NTWYFDIGHVYICN-LRSZDJBLSA-N.
| Molecular formula | C8H14O8 |
|---|---|
| Molecular weight | 238.19 g/mol |
| IUPAC name | 2-[(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexoxy]acetic acid |
| InChIKey | NTWYFDIGHVYICN-LRSZDJBLSA-N |
| SMILES | C([C@H]([C@H]([C@@H]([C@H](C=O)O)O)O)O)OCC(=O)O |
Computed by PubChem (NCBI)