CAS 101494-82-0 appears in our catalog under these names: 5-Bromo-3-phenyl-1,2,4-thiadiazole, 5-Bromo-3-phenyl-1,2,4-thiadiazole, 95%. Offered by: TRC, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 50mg, 0,5g.
5-bromo-3-phenyl-1,2,4-thiadiazole (CAS 101494-82-0) is a chemical compound with the molecular formula C8H5BrN2S and a molecular weight of 241.11 g/mol. IUPAC name: 5-bromo-3-phenyl-1,2,4-thiadiazole. InChIKey: ZRWWEJIHJFHGTH-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2S |
|---|---|
| Molecular weight | 241.11 g/mol |
| IUPAC name | 5-bromo-3-phenyl-1,2,4-thiadiazole |
| InChIKey | ZRWWEJIHJFHGTH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NSC(=N2)Br |
Computed by PubChem (NCBI)