CAS 1142195-09-2 appears in our catalog under these names: 2-(4-Bromo-1,3-thiazol-2-yl)pyridine, 2-(4-Bromo-1,3-thiazol-2-yl)pyridine, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 1g.
4-bromo-2-pyridin-2-yl-1,3-thiazole (CAS 1142195-09-2) is a chemical compound with the molecular formula C8H5BrN2S and a molecular weight of 241.11 g/mol. IUPAC name: 4-bromo-2-pyridin-2-yl-1,3-thiazole. InChIKey: DYXMAMIOTZLKIL-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2S |
|---|---|
| Molecular weight | 241.11 g/mol |
| IUPAC name | 4-bromo-2-pyridin-2-yl-1,3-thiazole |
| InChIKey | DYXMAMIOTZLKIL-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=NC(=CS2)Br |
Computed by PubChem (NCBI)