CAS 101495-43-6 is the registry number for 3-Bromo-5-phenyl-1,2,4-thiadiazole, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
3-bromo-5-phenyl-1,2,4-thiadiazole (CAS 101495-43-6) is a chemical compound with the molecular formula C8H5BrN2S and a molecular weight of 241.11 g/mol. IUPAC name: 3-bromo-5-phenyl-1,2,4-thiadiazole. InChIKey: XFBJWQGWDVKNTQ-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2S |
|---|---|
| Molecular weight | 241.11 g/mol |
| IUPAC name | 3-bromo-5-phenyl-1,2,4-thiadiazole |
| InChIKey | XFBJWQGWDVKNTQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NS2)Br |
Computed by PubChem (NCBI)