CAS 101513-79-5 is the registry number for 3-Chloro-2,4,5-trifluorobenzyl alcohol. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(3-chloro-2,4,5-trifluorophenyl)methanol (CAS 101513-79-5) is a chemical compound with the molecular formula C7H4ClF3O and a molecular weight of 196.55 g/mol. IUPAC name: (3-chloro-2,4,5-trifluorophenyl)methanol. InChIKey: HGUFDLHAHPQKOQ-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF3O |
|---|---|
| Molecular weight | 196.55 g/mol |
| IUPAC name | (3-chloro-2,4,5-trifluorophenyl)methanol |
| InChIKey | HGUFDLHAHPQKOQ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)F)Cl)F)CO |
Computed by PubChem (NCBI)