CAS 1015460-59-9 appears in our catalog under these names: 7–Bromo–5H–pyrido(4,3–b)indole, 7-Bromo-5H-pyrido[4,3-b]indole, 98%, 98%, 7-Bromo-5H-pyrido[4,3-b]indole, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 50g, 100g, 100mg, 5g, 10g, 25g.
7-bromo-5H-pyrido[4,3-b]indole (CAS 1015460-59-9) is a chemical compound with the molecular formula C11H7BrN2 and a molecular weight of 247.09 g/mol. IUPAC name: 7-bromo-5H-pyrido[4,3-b]indole. InChIKey: JYFKMOCKASWCPZ-UHFFFAOYSA-N.
| Molecular formula | C11H7BrN2 |
|---|---|
| Molecular weight | 247.09 g/mol |
| IUPAC name | 7-bromo-5H-pyrido[4,3-b]indole |
| InChIKey | JYFKMOCKASWCPZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)NC3=C2C=NC=C3 |
Computed by PubChem (NCBI)