Products 1015480-87-1

CAS 1015480-87-1 appears in our catalog under these names: 3,6-Dimethoxylpyridazine-4-boronic acid, 97%, (3,6-Dimethoxypyridazin-4-yl)boronic acid 98%, (3,6-Dimethoxypyridazin-4-yl)boronic acid, 97%, 97%, (3,6-Dimethoxypyridazin-4-yl)boronic acid, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 10g.

Structural formula: {0} (CAS {1})

(3,6-dimethoxypyridazin-4-yl)boronic acid (CAS 1015480-87-1) is a chemical compound with the molecular formula C6H9BN2O4 and a molecular weight of 183.96 g/mol. IUPAC name: (3,6-dimethoxypyridazin-4-yl)boronic acid. InChIKey: ZMMDVCDFKFTXIC-UHFFFAOYSA-N.

Identity
Molecular formulaC6H9BN2O4
Molecular weight183.96 g/mol
IUPAC name(3,6-dimethoxypyridazin-4-yl)boronic acid
InChIKeyZMMDVCDFKFTXIC-UHFFFAOYSA-N
SMILESB(C1=CC(=NN=C1OC)OC)(O)O

Computed by PubChem (NCBI)