CAS 223418-73-3 appears in our catalog under these names: 1,3-Dimethylpyrimidine-2,4-dione-5-boronic acid, 98%, (1,3-Dimethyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidin-5-yl)boronic acid, 98%, 1,3-Dimethylpyrimidine-2,4-dione-5-boronic acid, ≥95%, ≥95%, (1,3-Dimethyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidin-5-yl)boronic acid. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg.
(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)boronic acid (CAS 223418-73-3) is a chemical compound with the molecular formula C6H9BN2O4 and a molecular weight of 183.96 g/mol. IUPAC name: (1,3-dimethyl-2,4-dioxopyrimidin-5-yl)boronic acid. InChIKey: YTOIPKGEWGCXCG-UHFFFAOYSA-N.
| Molecular formula | C6H9BN2O4 |
|---|---|
| Molecular weight | 183.96 g/mol |
| IUPAC name | (1,3-dimethyl-2,4-dioxopyrimidin-5-yl)boronic acid |
| InChIKey | YTOIPKGEWGCXCG-UHFFFAOYSA-N |
| SMILES | B(C1=CN(C(=O)N(C1=O)C)C)(O)O |
Computed by PubChem (NCBI)