CAS 1146614-50-7 appears in our catalog under these names: (1-(2-Methoxy-2-oxoethyl)-1H-pyrazol-4-yl)boronic acid, 95%, 95%, (1-(2-Methoxy-2-oxoethyl)-1H-pyrazol-4-yl)boronic acid, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 100mg, 250mg, 5g.
[1-(2-methoxy-2-oxoethyl)pyrazol-4-yl]boronic acid (CAS 1146614-50-7) is a chemical compound with the molecular formula C6H9BN2O4 and a molecular weight of 183.96 g/mol. IUPAC name: [1-(2-methoxy-2-oxoethyl)pyrazol-4-yl]boronic acid. InChIKey: FMZIGVJKMUFZCK-UHFFFAOYSA-N.
| Molecular formula | C6H9BN2O4 |
|---|---|
| Molecular weight | 183.96 g/mol |
| IUPAC name | [1-(2-methoxy-2-oxoethyl)pyrazol-4-yl]boronic acid |
| InChIKey | FMZIGVJKMUFZCK-UHFFFAOYSA-N |
| SMILES | B(C1=CN(N=C1)CC(=O)OC)(O)O |
Computed by PubChem (NCBI)