Products 1015609-03-6
CAS 1015609-03-6 is the registry number for 1-(3-Iodo-1h-pyrrolo[2,3-b]pyridin-5-yl)ethanone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-(3-iodo-1H-pyrrolo[2,3-b]pyridin-5-yl)ethanone (CAS 1015609-03-6) is a chemical compound with the molecular formula C9H7IN2O and a molecular weight of 286.07 g/mol. IUPAC name: 1-(3-iodo-1H-pyrrolo[2,3-b]pyridin-5-yl)ethanone. InChIKey: SGQVDDRXKXQBMT-UHFFFAOYSA-N.
| Molecular formula | C9H7IN2O |
|---|---|
| Molecular weight | 286.07 g/mol |
| IUPAC name | 1-(3-iodo-1H-pyrrolo[2,3-b]pyridin-5-yl)ethanone |
| InChIKey | SGQVDDRXKXQBMT-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(NC=C2I)N=C1 |
Computed by PubChem (NCBI)