CAS 2581778-87-0 is the registry number for 1-(6-Iodoimidazo[1,2-a]pyridin-3-yl)ethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(6-iodoimidazo[1,2-a]pyridin-3-yl)ethanone (CAS 2581778-87-0) is a chemical compound with the molecular formula C9H7IN2O and a molecular weight of 286.07 g/mol. IUPAC name: 1-(6-iodoimidazo[1,2-a]pyridin-3-yl)ethanone. InChIKey: LCVIZJJCDXJGNK-UHFFFAOYSA-N.
| Molecular formula | C9H7IN2O |
|---|---|
| Molecular weight | 286.07 g/mol |
| IUPAC name | 1-(6-iodoimidazo[1,2-a]pyridin-3-yl)ethanone |
| InChIKey | LCVIZJJCDXJGNK-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CN=C2N1C=C(C=C2)I |
Computed by PubChem (NCBI)