CAS 2417310-23-5 is the registry number for 3-Iodo-1-methyl-1,7-naphthyridin-2(1H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-iodo-1-methyl-1,7-naphthyridin-2-one (CAS 2417310-23-5) is a chemical compound with the molecular formula C9H7IN2O and a molecular weight of 286.07 g/mol. IUPAC name: 3-iodo-1-methyl-1,7-naphthyridin-2-one. InChIKey: SQQNUDNUNCDPAA-UHFFFAOYSA-N.
| Molecular formula | C9H7IN2O |
|---|---|
| Molecular weight | 286.07 g/mol |
| IUPAC name | 3-iodo-1-methyl-1,7-naphthyridin-2-one |
| InChIKey | SQQNUDNUNCDPAA-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CN=C2)C=C(C1=O)I |
Computed by PubChem (NCBI)