Products 1015846-86-2
CAS 1015846-86-2 appears in our catalog under these names: 2,7-Dimethylpyrazolo[1,5-a]pyrimidine-5-carboxylic acid, 98%, 2,7-Dimethylpyrazolo(1,5-a)pyrimidine-5-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 250mg, 1g, 0,5g.
2,7-dimethylpyrazolo[1,5-a]pyrimidine-5-carboxylic acid (CAS 1015846-86-2) is a chemical compound with the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. IUPAC name: 2,7-dimethylpyrazolo[1,5-a]pyrimidine-5-carboxylic acid. InChIKey: MRDPXJMGOYYABT-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O2 |
|---|---|
| Molecular weight | 191.19 g/mol |
| IUPAC name | 2,7-dimethylpyrazolo[1,5-a]pyrimidine-5-carboxylic acid |
| InChIKey | MRDPXJMGOYYABT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=CC(=NN12)C)C(=O)O |
Computed by PubChem (NCBI)