CAS 1015856-60-6 appears in our catalog under these names: Flunixin-d3, Flunixin-d3, >95% (HPLC), Flunixin D3 (methyl D3), Flunixin D3 (methyl D3) 100 µg/mL in Acetonitrile, Flunixin–d3. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, GLPBio, Sigma-Aldrich. Available pack sizes: on request, 10mg, 1mg, 1ml, 5mg, 1 mg, 1x1ml, 1x10mg.
2-[2-(trideuteriomethyl)-3-(trifluoromethyl)anilino]pyridine-3-carboxylic acid (CAS 1015856-60-6) is a chemical compound with the molecular formula C14H11F3N2O2 and a molecular weight of 299.26 g/mol. IUPAC name: 2-[2-(trideuteriomethyl)-3-(trifluoromethyl)anilino]pyridine-3-carboxylic acid. InChIKey: NOOCSNJCXJYGPE-FIBGUPNXSA-N.
| Molecular formula | C14H11F3N2O2 |
|---|---|
| Molecular weight | 299.26 g/mol |
| IUPAC name | 2-[2-(trideuteriomethyl)-3-(trifluoromethyl)anilino]pyridine-3-carboxylic acid |
| InChIKey | NOOCSNJCXJYGPE-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=C(C=CC=C1NC2=C(C=CC=N2)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)