CAS 926254-24-2 is the registry number for 1-(3-(Trifluoromethyl)phenyl)-1H,4H,5H,6H-cyclopenta(c)pyrazole-3-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
1-[3-(trifluoromethyl)phenyl]-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxylic acid (CAS 926254-24-2) is a chemical compound with the molecular formula C14H11F3N2O2 and a molecular weight of 296.24 g/mol. IUPAC name: 1-[3-(trifluoromethyl)phenyl]-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxylic acid. InChIKey: BCKKDVXQFGXEFY-UHFFFAOYSA-N.
| Molecular formula | C14H11F3N2O2 |
|---|---|
| Molecular weight | 296.24 g/mol |
| IUPAC name | 1-[3-(trifluoromethyl)phenyl]-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxylic acid |
| InChIKey | BCKKDVXQFGXEFY-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)N(N=C2C(=O)O)C3=CC=CC(=C3)C(F)(F)F |
Computed by PubChem (NCBI)