CAS 263559-01-9 is the registry number for (2-Aminophenyl)-N-(4-(trifluoromethoxy)phenyl)formamide. Offered by: Biosynth. Available pack sizes: 2000mg, 1000mg, 5000mg, 10000mg.
2-amino-N-[4-(trifluoromethoxy)phenyl]benzamide (CAS 263559-01-9) is a chemical compound with the molecular formula C14H11F3N2O2 and a molecular weight of 296.24 g/mol. IUPAC name: 2-amino-N-[4-(trifluoromethoxy)phenyl]benzamide. InChIKey: LEXCDQLJUIFYHC-UHFFFAOYSA-N.
| Molecular formula | C14H11F3N2O2 |
|---|---|
| Molecular weight | 296.24 g/mol |
| IUPAC name | 2-amino-N-[4-(trifluoromethoxy)phenyl]benzamide |
| InChIKey | LEXCDQLJUIFYHC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NC2=CC=C(C=C2)OC(F)(F)F)N |
Computed by PubChem (NCBI)