CAS 1016503-65-3 appears in our catalog under these names: 2-(Chloromethyl)-5-(2,6-dichlorophenyl)-1,3,4-oxadiazole, 95%, 2-(Chloromethyl)-5-(2,6-dichlorophenyl)-1,3,4-oxadiazole. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
2-(chloromethyl)-5-(2,6-dichlorophenyl)-1,3,4-oxadiazole (CAS 1016503-65-3) is a chemical compound with the molecular formula C9H5Cl3N2O and a molecular weight of 263.5 g/mol. IUPAC name: 2-(chloromethyl)-5-(2,6-dichlorophenyl)-1,3,4-oxadiazole. InChIKey: URYHWFUSDRWJSL-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl3N2O |
|---|---|
| Molecular weight | 263.5 g/mol |
| IUPAC name | 2-(chloromethyl)-5-(2,6-dichlorophenyl)-1,3,4-oxadiazole |
| InChIKey | URYHWFUSDRWJSL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C2=NN=C(O2)CCl)Cl |
Computed by PubChem (NCBI)