CAS 1039885-60-3 appears in our catalog under these names: 3-(Chloromethyl)-5-(2,3-dichlorophenyl)-1,2,4-oxadiazole, 3-(Chloromethyl)-5-(2,3-dichlorophenyl)-1,2,4-oxadiazole, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 5g.
3-(chloromethyl)-5-(2,3-dichlorophenyl)-1,2,4-oxadiazole (CAS 1039885-60-3) is a chemical compound with the molecular formula C9H5Cl3N2O and a molecular weight of 263.5 g/mol. IUPAC name: 3-(chloromethyl)-5-(2,3-dichlorophenyl)-1,2,4-oxadiazole. InChIKey: RYTCZGKVPLJNMI-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl3N2O |
|---|---|
| Molecular weight | 263.5 g/mol |
| IUPAC name | 3-(chloromethyl)-5-(2,3-dichlorophenyl)-1,2,4-oxadiazole |
| InChIKey | RYTCZGKVPLJNMI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)C2=NC(=NO2)CCl |
Computed by PubChem (NCBI)