CAS 183368-35-6 is the registry number for 2-(Chloromethyl)-5-(2,4-dichlorophenyl)-1,3,4-oxadiazole. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(chloromethyl)-5-(2,4-dichlorophenyl)-1,3,4-oxadiazole (CAS 183368-35-6) is a chemical compound with the molecular formula C9H5Cl3N2O and a molecular weight of 263.5 g/mol. IUPAC name: 2-(chloromethyl)-5-(2,4-dichlorophenyl)-1,3,4-oxadiazole. InChIKey: PRFJGLYRTYUAFU-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl3N2O |
|---|---|
| Molecular weight | 263.5 g/mol |
| IUPAC name | 2-(chloromethyl)-5-(2,4-dichlorophenyl)-1,3,4-oxadiazole |
| InChIKey | PRFJGLYRTYUAFU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C2=NN=C(O2)CCl |
Computed by PubChem (NCBI)