CAS 1016530-93-0 is the registry number for 3-(2,4-Difluorophenyl)-1H-1,2,4-triazol-5-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(2,4-difluorophenyl)-1H-1,2,4-triazol-3-amine (CAS 1016530-93-0) is a chemical compound with the molecular formula C8H6F2N4 and a molecular weight of 196.16 g/mol. IUPAC name: 5-(2,4-difluorophenyl)-1H-1,2,4-triazol-3-amine. InChIKey: OTXZHWWLPHZGMU-UHFFFAOYSA-N.
| Molecular formula | C8H6F2N4 |
|---|---|
| Molecular weight | 196.16 g/mol |
| IUPAC name | 5-(2,4-difluorophenyl)-1H-1,2,4-triazol-3-amine |
| InChIKey | OTXZHWWLPHZGMU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)C2=NC(=NN2)N |
Computed by PubChem (NCBI)