CAS 1523323-06-9 is the registry number for 1-(2,4-Difluorophenyl)-1H-1,2,3-triazol-4-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1-(2,4-difluorophenyl)triazol-4-amine (CAS 1523323-06-9) is a chemical compound with the molecular formula C8H6F2N4 and a molecular weight of 196.16 g/mol. IUPAC name: 1-(2,4-difluorophenyl)triazol-4-amine. InChIKey: IYGYSKMLOKDYHM-UHFFFAOYSA-N.
| Molecular formula | C8H6F2N4 |
|---|---|
| Molecular weight | 196.16 g/mol |
| IUPAC name | 1-(2,4-difluorophenyl)triazol-4-amine |
| InChIKey | IYGYSKMLOKDYHM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)N2C=C(N=N2)N |
Computed by PubChem (NCBI)