CAS 925698-99-3 is the registry number for 5-((2,4-Difluorophenyl)methyl)-1H-1,2,3,4-tetrazole. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
5-[(2,4-difluorophenyl)methyl]-2H-tetrazole (CAS 925698-99-3) is a chemical compound with the molecular formula C8H6F2N4 and a molecular weight of 196.16 g/mol. IUPAC name: 5-[(2,4-difluorophenyl)methyl]-2H-tetrazole. InChIKey: AJSDIMVQQSJLOQ-UHFFFAOYSA-N.
| Molecular formula | C8H6F2N4 |
|---|---|
| Molecular weight | 196.16 g/mol |
| IUPAC name | 5-[(2,4-difluorophenyl)methyl]-2H-tetrazole |
| InChIKey | AJSDIMVQQSJLOQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)CC2=NNN=N2 |
Computed by PubChem (NCBI)