Products 1016532-76-5

CAS 1016532-76-5 appears in our catalog under these names: 4-(Propylsulfamoyl)benzene-1-sulfonyl chloride, 95%, 4-(Propylsulfamoyl)benzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.

4-(propylsulfamoyl)benzenesulfonyl chloride (CAS 1016532-76-5) is a chemical compound with the molecular formula C9H12ClNO4S2 and a molecular weight of 297.8 g/mol. IUPAC name: 4-(propylsulfamoyl)benzenesulfonyl chloride. InChIKey: OCJMNPQFOAGECF-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12ClNO4S2
Molecular weight297.8 g/mol
IUPAC name4-(propylsulfamoyl)benzenesulfonyl chloride
InChIKeyOCJMNPQFOAGECF-UHFFFAOYSA-N
SMILESCCCNS(=O)(=O)C1=CC=C(C=C1)S(=O)(=O)Cl

Computed by PubChem (NCBI)