Products 926210-62-0

CAS 926210-62-0 is the registry number for 4-Ethanesulfonamido-2-methylbenzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

4-(ethylsulfonylamino)-2-methylbenzenesulfonyl chloride (CAS 926210-62-0) is a chemical compound with the molecular formula C9H12ClNO4S2 and a molecular weight of 297.8 g/mol. IUPAC name: 4-(ethylsulfonylamino)-2-methylbenzenesulfonyl chloride. InChIKey: AVBCZUGVLMGKCL-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12ClNO4S2
Molecular weight297.8 g/mol
IUPAC name4-(ethylsulfonylamino)-2-methylbenzenesulfonyl chloride
InChIKeyAVBCZUGVLMGKCL-UHFFFAOYSA-N
SMILESCCS(=O)(=O)NC1=CC(=C(C=C1)S(=O)(=O)Cl)C

Computed by PubChem (NCBI)