Products 155731-15-0

CAS 155731-15-0 is the registry number for 2-(tert-Butylsulfamoyl)-5-chlorothiophene-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-(tert-butylsulfamoyl)-5-chlorothiophene-3-carboxylic acid (CAS 155731-15-0) is a chemical compound with the molecular formula C9H12ClNO4S2 and a molecular weight of 297.8 g/mol. IUPAC name: 2-(tert-butylsulfamoyl)-5-chlorothiophene-3-carboxylic acid. InChIKey: AAGPMZWZIZWWFA-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12ClNO4S2
Molecular weight297.8 g/mol
IUPAC name2-(tert-butylsulfamoyl)-5-chlorothiophene-3-carboxylic acid
InChIKeyAAGPMZWZIZWWFA-UHFFFAOYSA-N
SMILESCC(C)(C)NS(=O)(=O)C1=C(C=C(S1)Cl)C(=O)O

Computed by PubChem (NCBI)