Products 101660-96-2
CAS 101660-96-2 is the registry number for (R)-2-(1,3-Dioxoisoindolin-2-yl)propyl 4-methylbenzenesulfonate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R)-2-(1,3-dioxoisoindol-2-yl)propyl] 4-methylbenzenesulfonate (CAS 101660-96-2) is a chemical compound with the molecular formula C18H17NO5S and a molecular weight of 359.4 g/mol. IUPAC name: [(2R)-2-(1,3-dioxoisoindol-2-yl)propyl] 4-methylbenzenesulfonate. InChIKey: NQQWBOYKFRRXER-CYBMUJFWSA-N.
| Molecular formula | C18H17NO5S |
|---|---|
| Molecular weight | 359.4 g/mol |
| IUPAC name | [(2R)-2-(1,3-dioxoisoindol-2-yl)propyl] 4-methylbenzenesulfonate |
| InChIKey | NQQWBOYKFRRXER-CYBMUJFWSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC[C@@H](C)N2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)