Products 1316891-34-5
CAS 1316891-34-5 is the registry number for 4-((2,3-Dimethyl-5-sulfo-3H-indol-3-yl)methyl)benzoic acid, 98%, 98%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 50mg.
4-[(2,3-dimethyl-5-sulfoindol-3-yl)methyl]benzoic acid (CAS 1316891-34-5) is a chemical compound with the molecular formula C18H17NO5S and a molecular weight of 359.4 g/mol. IUPAC name: 4-[(2,3-dimethyl-5-sulfoindol-3-yl)methyl]benzoic acid. InChIKey: NWJCQLOHSVQMMA-UHFFFAOYSA-N.
| Molecular formula | C18H17NO5S |
|---|---|
| Molecular weight | 359.4 g/mol |
| IUPAC name | 4-[(2,3-dimethyl-5-sulfoindol-3-yl)methyl]benzoic acid |
| InChIKey | NWJCQLOHSVQMMA-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C1(C)CC3=CC=C(C=C3)C(=O)O)C=C(C=C2)S(=O)(=O)O |
Computed by PubChem (NCBI)