Products 88722-24-1

CAS 88722-24-1 is the registry number for (2S)-2-(1,3-Dioxoisoindol-2-yl)propyl 4-methylbenzenesulfonate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g, 25g.

Structural formula: {0} (CAS {1})

[(2S)-2-(1,3-dioxoisoindol-2-yl)propyl] 4-methylbenzenesulfonate (CAS 88722-24-1) is a chemical compound with the molecular formula C18H17NO5S and a molecular weight of 359.4 g/mol. IUPAC name: [(2S)-2-(1,3-dioxoisoindol-2-yl)propyl] 4-methylbenzenesulfonate. InChIKey: NQQWBOYKFRRXER-ZDUSSCGKSA-N.

Identity
Molecular formulaC18H17NO5S
Molecular weight359.4 g/mol
IUPAC name[(2S)-2-(1,3-dioxoisoindol-2-yl)propyl] 4-methylbenzenesulfonate
InChIKeyNQQWBOYKFRRXER-ZDUSSCGKSA-N
SMILESCC1=CC=C(C=C1)S(=O)(=O)OC[C@H](C)N2C(=O)C3=CC=CC=C3C2=O

Computed by PubChem (NCBI)