CAS 88722-24-1 is the registry number for (2S)-2-(1,3-Dioxoisoindol-2-yl)propyl 4-methylbenzenesulfonate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g, 25g.
[(2S)-2-(1,3-dioxoisoindol-2-yl)propyl] 4-methylbenzenesulfonate (CAS 88722-24-1) is a chemical compound with the molecular formula C18H17NO5S and a molecular weight of 359.4 g/mol. IUPAC name: [(2S)-2-(1,3-dioxoisoindol-2-yl)propyl] 4-methylbenzenesulfonate. InChIKey: NQQWBOYKFRRXER-ZDUSSCGKSA-N.
| Molecular formula | C18H17NO5S |
|---|---|
| Molecular weight | 359.4 g/mol |
| IUPAC name | [(2S)-2-(1,3-dioxoisoindol-2-yl)propyl] 4-methylbenzenesulfonate |
| InChIKey | NQQWBOYKFRRXER-ZDUSSCGKSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC[C@H](C)N2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)