CAS 1016673-28-1 is the registry number for 3-Amino-n-(2-methyl-1,3-dioxo-2,3-dihydro-1h-isoindol-5-yl), 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-amino-N-(2-methyl-1,3-dioxoisoindol-5-yl)propanamide (CAS 1016673-28-1) is a chemical compound with the molecular formula C12H13N3O3 and a molecular weight of 247.25 g/mol. IUPAC name: 3-amino-N-(2-methyl-1,3-dioxoisoindol-5-yl)propanamide. InChIKey: OBJJRNIUJHJVHO-UHFFFAOYSA-N.
| Molecular formula | C12H13N3O3 |
|---|---|
| Molecular weight | 247.25 g/mol |
| IUPAC name | 3-amino-N-(2-methyl-1,3-dioxoisoindol-5-yl)propanamide |
| InChIKey | OBJJRNIUJHJVHO-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C2=C(C1=O)C=C(C=C2)NC(=O)CCN |
Computed by PubChem (NCBI)