Products 936074-71-4

CAS 936074-71-4 is the registry number for 1-[1,3]Oxazolo[4,5-b]pyridin-2-ylpiperidine-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

1-([1,3]oxazolo[4,5-b]pyridin-2-yl)piperidine-4-carboxylic acid (CAS 936074-71-4) is a chemical compound with the molecular formula C12H13N3O3 and a molecular weight of 247.25 g/mol. IUPAC name: 1-([1,3]oxazolo[4,5-b]pyridin-2-yl)piperidine-4-carboxylic acid. InChIKey: GKYOKNGSKMTPCN-UHFFFAOYSA-N.

Identity
Molecular formulaC12H13N3O3
Molecular weight247.25 g/mol
IUPAC name1-([1,3]oxazolo[4,5-b]pyridin-2-yl)piperidine-4-carboxylic acid
InChIKeyGKYOKNGSKMTPCN-UHFFFAOYSA-N
SMILESC1CN(CCC1C(=O)O)C2=NC3=C(O2)C=CC=N3

Computed by PubChem (NCBI)