Products 883538-73-6

CAS 883538-73-6 is the registry number for 1-(2-Ethoxy-phenyl)-5-methyl-1h-[1,2,3]triazole-4-carboxylic acid, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

1-(2-ethoxyphenyl)-5-methyltriazole-4-carboxylic acid (CAS 883538-73-6) is a chemical compound with the molecular formula C12H13N3O3 and a molecular weight of 247.25 g/mol. IUPAC name: 1-(2-ethoxyphenyl)-5-methyltriazole-4-carboxylic acid. InChIKey: RWBSJSOLKFXQGX-UHFFFAOYSA-N.

Identity
Molecular formulaC12H13N3O3
Molecular weight247.25 g/mol
IUPAC name1-(2-ethoxyphenyl)-5-methyltriazole-4-carboxylic acid
InChIKeyRWBSJSOLKFXQGX-UHFFFAOYSA-N
SMILESCCOC1=CC=CC=C1N2C(=C(N=N2)C(=O)O)C

Computed by PubChem (NCBI)