CAS 1016674-58-0 is the registry number for 3-Chloro-n-[4-chloro-2-(trifluoromethyl)phenyl]propanamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-chloro-N-[4-chloro-2-(trifluoromethyl)phenyl]propanamide (CAS 1016674-58-0) is a chemical compound with the molecular formula C10H8Cl2F3NO and a molecular weight of 286.07 g/mol. IUPAC name: 3-chloro-N-[4-chloro-2-(trifluoromethyl)phenyl]propanamide. InChIKey: MHOIHCSSHTXOHX-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2F3NO |
|---|---|
| Molecular weight | 286.07 g/mol |
| IUPAC name | 3-chloro-N-[4-chloro-2-(trifluoromethyl)phenyl]propanamide |
| InChIKey | MHOIHCSSHTXOHX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(F)(F)F)NC(=O)CCCl |
Computed by PubChem (NCBI)