CAS 929973-73-9 appears in our catalog under these names: 2-Chloro-n-[4-chloro-2-(trifluoromethyl)phenyl]propanamide, 95%, N-(4-Chloro-2-trifluoromethylphenyl)-2-chloropropanamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g, 5000mg.
2-chloro-N-[4-chloro-2-(trifluoromethyl)phenyl]propanamide (CAS 929973-73-9) is a chemical compound with the molecular formula C10H8Cl2F3NO and a molecular weight of 286.07 g/mol. IUPAC name: 2-chloro-N-[4-chloro-2-(trifluoromethyl)phenyl]propanamide. InChIKey: JMAMOGLJJAPISH-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2F3NO |
|---|---|
| Molecular weight | 286.07 g/mol |
| IUPAC name | 2-chloro-N-[4-chloro-2-(trifluoromethyl)phenyl]propanamide |
| InChIKey | JMAMOGLJJAPISH-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NC1=C(C=C(C=C1)Cl)C(F)(F)F)Cl |
Computed by PubChem (NCBI)