CAS 878466-33-2 appears in our catalog under these names: 2-Chloro-N-(4-chlorophenyl)-N-(2,2,2-trifluoroethyl)acetamide, 95%, 2-Chloro-N-(4-chlorophenyl)-N-(2,2,2-trifluoroethyl)acetamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
2-chloro-N-(4-chlorophenyl)-N-(2,2,2-trifluoroethyl)acetamide (CAS 878466-33-2) is a chemical compound with the molecular formula C10H8Cl2F3NO and a molecular weight of 286.07 g/mol. IUPAC name: 2-chloro-N-(4-chlorophenyl)-N-(2,2,2-trifluoroethyl)acetamide. InChIKey: HXRDBAJBPQQYSA-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2F3NO |
|---|---|
| Molecular weight | 286.07 g/mol |
| IUPAC name | 2-chloro-N-(4-chlorophenyl)-N-(2,2,2-trifluoroethyl)acetamide |
| InChIKey | HXRDBAJBPQQYSA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N(CC(F)(F)F)C(=O)CCl)Cl |
Computed by PubChem (NCBI)