CAS 1016701-95-3 is the registry number for 4-Cyano-3-(trifluoromethyl)benzenesulfonyl Chloride. Offered by: TRC. Available pack sizes: 1g.
4-cyano-2-(trifluoromethyl)benzenesulfonyl chloride (CAS 1016701-95-3) is a chemical compound with the molecular formula C8H3ClF3NO2S and a molecular weight of 269.63 g/mol. IUPAC name: 4-cyano-2-(trifluoromethyl)benzenesulfonyl chloride. InChIKey: DMRMWUNIFCEILQ-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF3NO2S |
|---|---|
| Molecular weight | 269.63 g/mol |
| IUPAC name | 4-cyano-2-(trifluoromethyl)benzenesulfonyl chloride |
| InChIKey | DMRMWUNIFCEILQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C#N)C(F)(F)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)