CAS 942199-59-9 appears in our catalog under these names: 4-Cyano-3-(trifluoromethyl)benzene-1-sulfonyl chloride, 95%, 4–Cyano–3–(trifluoromethyl)benzene–1–sulfonyl chloride, 4-cyano-3-(trifluoromethyl)benzene-1-sulfonyl chloride, 4-Cyano-3-(trifluoromethyl)benzene-1-sulfonyl chloride, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Ambeed. Available pack sizes: 1g, 100mg, 5g, 250mg, 50mg, 0,5g.
4-cyano-3-(trifluoromethyl)benzenesulfonyl chloride (CAS 942199-59-9) is a chemical compound with the molecular formula C8H3ClF3NO2S and a molecular weight of 269.63 g/mol. IUPAC name: 4-cyano-3-(trifluoromethyl)benzenesulfonyl chloride. InChIKey: YKHLEJBYHQQAMZ-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF3NO2S |
|---|---|
| Molecular weight | 269.63 g/mol |
| IUPAC name | 4-cyano-3-(trifluoromethyl)benzenesulfonyl chloride |
| InChIKey | YKHLEJBYHQQAMZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)Cl)C(F)(F)F)C#N |
Computed by PubChem (NCBI)