Products 1249999-95-8

CAS 1249999-95-8 appears in our catalog under these names: 2-Cyano-4-(trifluoromethyl)benzene-1-sulfonyl chloride, 95%, 2-Cyano-4-(trifluoromethyl)benzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.

Structural formula: {0} (CAS {1})

2-cyano-4-(trifluoromethyl)benzenesulfonyl chloride (CAS 1249999-95-8) is a chemical compound with the molecular formula C8H3ClF3NO2S and a molecular weight of 269.63 g/mol. IUPAC name: 2-cyano-4-(trifluoromethyl)benzenesulfonyl chloride. InChIKey: MITFCFJALKLPLC-UHFFFAOYSA-N.

Identity
Molecular formulaC8H3ClF3NO2S
Molecular weight269.63 g/mol
IUPAC name2-cyano-4-(trifluoromethyl)benzenesulfonyl chloride
InChIKeyMITFCFJALKLPLC-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C(F)(F)F)C#N)S(=O)(=O)Cl

Computed by PubChem (NCBI)