CAS 1016711-67-3 is the registry number for 5-(5-Bromofuran-2-yl)-1,3,4-oxadiazol-2-amine, 97%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
5-(5-bromofuran-2-yl)-1,3,4-oxadiazol-2-amine (CAS 1016711-67-3) is a chemical compound with the molecular formula C6H4BrN3O2 and a molecular weight of 230.02 g/mol. IUPAC name: 5-(5-bromofuran-2-yl)-1,3,4-oxadiazol-2-amine. InChIKey: RJGODGJKZREBSD-UHFFFAOYSA-N.
| Molecular formula | C6H4BrN3O2 |
|---|---|
| Molecular weight | 230.02 g/mol |
| IUPAC name | 5-(5-bromofuran-2-yl)-1,3,4-oxadiazol-2-amine |
| InChIKey | RJGODGJKZREBSD-UHFFFAOYSA-N |
| SMILES | C1=C(OC(=C1)Br)C2=NN=C(O2)N |
Computed by PubChem (NCBI)