CAS 2376926-19-9 is the registry number for 6-Bromo-2H-pyrazino(2,3-b)(1,4)oxazin-3(4H)-one, 98%. Offered by: AmBeed. Available pack sizes: 1g.
6-bromo-4H-pyrazino[2,3-b][1,4]oxazin-3-one (CAS 2376926-19-9) is a chemical compound with the molecular formula C6H4BrN3O2 and a molecular weight of 230.02 g/mol. IUPAC name: 6-bromo-4H-pyrazino[2,3-b][1,4]oxazin-3-one. InChIKey: NEPNIKOILXVJQH-UHFFFAOYSA-N.
| Molecular formula | C6H4BrN3O2 |
|---|---|
| Molecular weight | 230.02 g/mol |
| IUPAC name | 6-bromo-4H-pyrazino[2,3-b][1,4]oxazin-3-one |
| InChIKey | NEPNIKOILXVJQH-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=NC(=CN=C2O1)Br |
Computed by PubChem (NCBI)