CAS 20419-74-3 is the registry number for 7-Bromo-1H,2H,3H,4H,5H-pyrrolo(3,2-d)pyrimidine-2,4-dione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
7-bromo-1,5-dihydropyrrolo[3,2-d]pyrimidine-2,4-dione (CAS 20419-74-3) is a chemical compound with the molecular formula C6H4BrN3O2 and a molecular weight of 230.02 g/mol. IUPAC name: 7-bromo-1,5-dihydropyrrolo[3,2-d]pyrimidine-2,4-dione. InChIKey: VGTQTXDPTYNVJJ-UHFFFAOYSA-N.
| Molecular formula | C6H4BrN3O2 |
|---|---|
| Molecular weight | 230.02 g/mol |
| IUPAC name | 7-bromo-1,5-dihydropyrrolo[3,2-d]pyrimidine-2,4-dione |
| InChIKey | VGTQTXDPTYNVJJ-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(N1)C(=O)NC(=O)N2)Br |
Computed by PubChem (NCBI)